Unsubstituted Phenols
Aobchem 2-Bromo-6-(tert-butyl)phenol | ≥95% | CAS 23159-87-7 | C10H13BrO | 5g
2-Bromo-6-(tert-butyl)phenol | ≥95% | CAS 23159-87-7 | C10H13BrO | 5g
Aobchem Phenol 2-chloro-4-fluoro- acetate | ≥97% | CAS 301653-18-9 | C8H6ClFO2 | 5g
Phenol 2-chloro-4-fluoro- acetate | ≥97% | CAS 301653-18-9 | C8H6ClFO2 | 5g
Aobchem 4-(3-Fluorophenyl)phenol | ≥97% | CAS 64465-61-8 | C12H9FO | 1g
4-(3-Fluorophenyl)phenol | ≥97% | CAS 64465-61-8 | C12H9FO | 1g
Aobchem 2 4-Dichloro-5-iodo-phenol | ≥97% | CAS 335014-73-8 | C6H3Cl2IO | 500mg
2 4-Dichloro-5-iodo-phenol | ≥97% | CAS 335014-73-8 | C6H3Cl2IO | 500mg
Aobchem 3 5-Dichlor-2-methyl-phenol | ≥95% | CAS 56680-66-1 | C7H6Cl2O | 250mg
3 5-Dichlor-2-methyl-phenol | ≥95% | CAS 56680-66-1 | C7H6Cl2O | 250mg
Aobchem 2 4-Dichloro-5-iodo-phenol | ≥97% | CAS 335014-73-8 | C6H3Cl2IO | 1g
2 4-Dichloro-5-iodo-phenol | ≥97% | CAS 335014-73-8 | C6H3Cl2IO | 1g
Aobchem 5-Bromo-2-(tert-butyl)phenol | ≥95% | CAS 30715-50-5 | C10H13BrO | 500mg
5-Bromo-2-(tert-butyl)phenol | ≥95% | CAS 30715-50-5 | C10H13BrO | 500mg
Medchemexpress LLC Dibenzo[a,c]cycloocten-1-ol, 5,6,7,8-tetrahydro-2,3,10,11,12-pentamethoxy-6,7-dimethyl- | 69363-14-0 | 402.48 | 100 MG
Dibenzo[a,c]cycloocten-1-ol, 5,6,7,8-tetrahydro-2,3,10,11,12-pentamethoxy-6,7-dimethyl- | 69363-14-0 | 402.48 | 100 MG
Sigma Aldrich Fine Chemicals Biosciences ficollR 400 BioXtra for mo100G
ficoll(R) 400 is a non-ionic synthetic polymer of sucrose used for cell separation and organ isolation.
![eMolecules 33162-17-3 | 2,8-Dimethyl-2,3,4,4a,5,9b-hexahydro-1H-pyrido[4,3-b]indole dihydrochloride | Apollo Scientific | MFCD00444963 | 275.220 | C13H20Cl2N2 | 95.000 | Cl.Cl.CN1CCC2Nc3ccc(C)cc3C2C1 | 1g | 562458260](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502161151.JPG-250.jpg)
eMolecules 33162-17-3 | 2,8-Dimethyl-2,3,4,4a,5,9b-hexahydro-1H-pyrido[4,3-b]indole dihydrochloride | Apollo Scientific | MFCD00444963 | 275.220 | C13H20Cl2N2 | 95.000 | Cl.Cl.CN1CCC2Nc3ccc(C)cc3C2C1 | 1g | 562458260
2,8-Dimethyl-2,3,4,4a,5,9b-hexahydro-1H-pyrido[4,3-b]indole dihydrochloride | Apollo Scientific | 33162-17-3 | MFCD00444963 | 275.220 | C13H20Cl2N2 | 95.000 | Cl.Cl.CN1CCC2Nc3ccc(C)cc3C2C1 | 1g | 562458260
eMolecules 71022-86-1 | 4-(3-Methoxyphenyl)phenol | Combi-Blocks | MFCD06802295 | 200.237 | C13H12O2 | 98.000 | COc1cccc(c1)-c1ccc(O)cc1 | 1g | 117578018
4-(3-Methoxyphenyl)phenol | Combi-Blocks | 71022-86-1 | MFCD06802295 | 200.237 | C13H12O2 | 98.000 | COc1cccc(c1)-c1ccc(O)cc1 | 1g | 117578018
eMolecules 154-02-9 | 5-Hydroxytryptophol | MFCD00047197 | 1g
ChemScene | 1-((3-Bromophenyl)sulfonyl)pyrrolidine | 250mg | 536803483 | CS-0097432 | 214210-14-7 | MFCD07363829 | 290.180 | C10H12BrNO2S
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
Medchemexpress LLC HY-107854 50mg Medchemexpress, N-Acetyl-5-hydroxytryptamine CAS:1210-83-9 Purity:>98%
Medchemexpress, HY-107854 50mg N-Acetyl-5-hydroxytryptamine CAS:1210-83-9 N-Acetyl-5-hydroxytryptamine is a Melatonin precursor, and that it can potently activate TrkB receptor. Purity:>98% Medchemexpress has over 10000 novel life-science reagents, reference compounds, APIs and natural compounds for laboratory and scientific use. Other quantity can also be offered.